3-methoxy-2-methyl-4-nitropyridine 1-oxide
An impurity of Pantoprazole which is a proton pump inhibitor used to treat erosive esophagitis (damage to the esophagus from stomach acid), and other conditions involving excess stomach acid such as Zollinger-Ellison syndrome.
| Supplier | BOC Sciences |
|---|---|
| Product # | 15931-25-6 |
| Pricing | Inquire |
| Cas | 15931-25-6 |
| Molecular Weight | 184.15 |
| Molecular Formula | C7H8N2O4 |
| Canonical SMILES | CC1=[N+](C=CC(=C1OC)[N+](=O)[O-])[O-] |