Folic Acid EP Impurity E
One of the impurities of Folic acid. Folic acid is a vitamin needed to synthesize DNA, conduct DNA repair and methylate DNA, and it also acts as a cofactor in biological reactions involving folate.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1391068-26-0 |
| Pricing | Inquire |
| Cas | 1391068-26-0 |
| Molecular Weight | 616.55 |
| Molecular Formula | C26H24N12O7 |
| Canonical SMILES | C1=CC(=CC=C1C(=O)NC(CCC(=O)O)C(=O)O)N(CC2=CN=C3C(=N2)C(=O)NC(=N3)N)CC4=CN=C5C(=N4)C(=O)NC(=N5)N |