Rapastinel acetate
Rapastinel, a brain penetrable tetrapeptide, could be a partial agonist of NMDA receptor. It was already finished the Phase II trial for acting as an antidepressant agent. It was just planed a phase III trial for Major depressive disorder.
| Supplier | BOC Sciences |
|---|---|
| Product # | 491872-39-0 |
| Pricing | Inquire |
| Cas | 491872-39-0 |
| Molecular Weight | 473.53 |
| Molecular Formula | C20H35N5O8 |
| Canonical SMILES | CC(C(C(=O)N1CCCC1C(=O)N2CCCC2C(=O)NC(C(C)O)C(=O)N)N)O.CC(=O)O |