A 80426 mesylate
A 80426 mesylate is a potent α2-adrenoceptor antagonist and a selective 5-HT uptake inhibitor (Ki = 2.01 and 3.77 nM, respectively). It displays low affinity for a panel of structurally homologous GPCRs.
| Supplier | BOC Sciences |
|---|---|
| Product # | 152148-64-6 |
| Pricing | Inquire |
| Cas | 152148-64-6 |
| Molecular Weight | 445.57 |
| Molecular Formula | C23H27NO2.CH3SO3H |
| Canonical SMILES | CN(CCC1=CC2=C(C=C1)C=CO2)CC3CCCC4=C3C=CC=C4OC.CS(=O)(=O)O |