6-Methylcoumarin
6-Methylcoumarin is a natural compound, possessing a panoply of biological activities and aiding in studying cancer and inflammation. It elicits fluorescence as an exquisite probe in the domain of biomedical imaging, while masterfully orchestrating the synthesis of pharmaceutical natural compounds.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP1107 |
| Pricing | Inquire |
| Cas | 92-48-8 |
| Molecular Weight | 160.172 |
| Molecular Formula | C10H8O2 |
| Canonical SMILES | CC1=CC2=C(C=C1)OC(=O)C=C2 |