Quinomycin B
Quinomycin B is originally isolated from Str. sp. 732. It has a strong effect on gram-positive bacteria and HeLa cells, and also on some gram-negative bacteria. It also has a protective effect on mice inoculated with poliovirus.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02166 |
| Pricing | Inquire |
| Cas | 13602-52-3 |
| Molecular Weight | 1129.31 |
| Molecular Formula | C53H68N12O12S2 |
| Canonical SMILES | CCC(C)C1C(=O)OCC(C(=O)NC(C(=O)N(C2C(SCC(C(=O)N1C)N(C(=O)C(NC(=O)C(COC(=O)C(N(C2=O)C)C(C)CC)NC(=O)C3=NC4=CC=CC=C4N=C3)C)C)SC)C)C)NC(=O)C5=NC6=CC=CC=C6N=C5 |