Antibiotic A 10255B
It is a cyclic thiopeptide antibiotic compound produced by the strain of Streptomyces gardneri. It has the effect of promoting ruminant growth and alleviating acidosis. It is used as a feed additive.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-03051 |
| Pricing | Inquire |
| Cas | 119166-38-0 |
| Molecular Weight | 1245.24 |
| Molecular Formula | C53H48N16O15S3 |
| Canonical SMILES | CCC=C1C2=NC(=CO2)C(=NCC3=NC(=CS3)C(=NC(C4=NC(=CS4)C(=NC(=C)C(=NC(=C)C5=NC(=CO5)C6=C(C=CC(=N6)C(=O)NC(=C)C(=NC(=C)C(=NC(=C)C(=NC(=C)C(=O)O)O)O)O)C7=NC(=CS7)C(=NC(C(=N1)O)C(C)O)O)O)O)C)O)O |