2-Fluoro-6-(trifluoromethyl)phenylboronic acid
2-Fluoro-6-(trifluoromethyl)phenylboronic acid is a pharmacological compound used primarily in the construction of various drug molecules. It plays a significant role in cancer research, helping synthesize drugs aimed at treating various malignancies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 313545-34-5 |
| Pricing | Inquire |
| Cas | 313545-34-5 |
| Molecular Weight | 207.92 |
| Molecular Formula | C7H5BF4O2 |
| Canonical SMILES | B(C1=C(C=CC=C1F)C(F)(F)F)(O)O |