DMTr-2'-O-4'-C-ethylene-rA(Bz)-3'-CE-Phosphoramidite
DMTr-2'-O-4'-C-ethylene-rA(Bz)-3'-CE-Phosphoramidite, used in oligonucleotide synthesis, contains an ethylene linker at the 2'-O and 4'-C positions of adenosine (rA), with benzoyl (Bz) protection on the adenine amino group. The cyanoethyl (CE) group at the 3'-end facilitates efficient coupling reactions during solid-phase synthesis. It is employed in the construction of RNA sequences with augmented stability and binding affinity, suitable for various research applications including RNA-targeted therapy and gene expression modulation.
| Supplier | BOC Sciences |
|---|---|
| Product # | BRP-00600 |
| Pricing | Inquire |
| Cas | 287737-45-5 |
| Molecular Weight | 899.99 |
| Molecular Formula | C49H54N7O8P |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1C2C(OC1(CCO2)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)N6C=NC7=C(N=CN=C76)NC(=O)C8=CC=CC=C8 |