2-Nitrophenyl 2-acetamido-2-deoxy-a-D-glucopyranoside
2-Nitrophenyl 2-acetamido-2-deoxy-α-D-glucopyranoside is a widely utilized biochemical compound within the biomedical industry, emerging as a substrate or constituent in enzymatic assays, conjugation reactions, and experimental investigations. It plays a pivotal role in comprehending diverse biological processes and studying molecular interactions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 10139-01-2 |
| Pricing | Inquire |
| Cas | 10139-01-2 |
| Molecular Weight | 342.3 |
| Molecular Formula | C14H18N2O8 |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1OC2=CC=CC=C2[N+](=O)[O-])CO)O)O |