Uridine 5'-Triphosphate Tris Salt
Uridine 5'-Triphosphate Tris Salt refers to uridine-5'-triphosphate (UTP) complexed with tromethamine (Tris) to form a stable salt. Similarly to other nucleotide Tris salts like ATP, GTP, and CTP, UTP Tris salt is commonly used in biochemical and molecular biology research where the presence of Tris is necessary to maintain a specific pH range in the experimental conditions. The addition of Tris to UTP allows researchers to control the pH of the solution while working with UTP, which is sensitive to changes in pH. UTP Tris salt is utilized in various enzymatic assays, RNA synthesis, and other biochemical experiments where maintaining a stable pH is crucial for the desired reactions. As a polyphosphate analogue of the nucleoside Uridine, Uridine 5'-Triphosphate Tris Salt can be used in the preparation of potent and selective agonists at the G-protein-coupled P2Y receptors.
Supplier | BOC Sciences |
---|---|
Product # | 108321-53-5 |
Pricing | Inquire |
Cas | 108321-53-5 |
Molecular Weight | 484.14 (free acid) |
Molecular Formula | C9H15N2O15P3.xC4H11NO3 |
Canonical SMILES | C1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O.C(C(CO)(CO)N)O |