4-METHOXY-2-(TRIFLUOROMETHYL)PHENYLBORONIC ACID
Reactant involved in:• Synthesis of pyrazine derivatives as corticotropin releasing factor-1 receptor antagonists• C-H functionalization of quinones• Phenyl-purine-carbonitrile derivative synthesis as cathepsin S inhibitors• Synthesis of chiral bicyclooctadiene-based ligands• Synthesis of corticotropin-releasing factor-1 antagonists
| Supplier | BOC Sciences |
|---|---|
| Product # | 313546-16-6 |
| Pricing | Inquire |
| Cas | 313546-16-6 |
| Molecular Weight | 219.95 |
| Molecular Formula | C8H8BF3O3 |
| Canonical SMILES | B(C1=C(C=C(C=C1)OC)C(F)(F)F)(O)O |