Monorden A
Monorden A is a metabolite of Humicola sp. FO-2942. It has the effect of arresting the cell cycle of Jurket cells in G1 and G2/M phases. It has anti-Aspergillus niger activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 12772-57-5 |
| Pricing | Inquire |
| Cas | 12772-57-5 |
| Molecular Weight | 364.78 |
| Molecular Formula | C18H17ClO6 |
| Canonical SMILES | CC1CC2C(O2)C=CC=CC(=O)CC3=C(C(=CC(=C3Cl)O)O)C(=O)O1 |