Sodium Demethylcantharidate
Sodium Demethylcantharidate is a cutting-edge natural compound with anti-cancer attributes. By impeding the enzymatic activity of protein phosphatase 2A, it orchestrates intricate cellular phenomena encompassing cell cycle arrest, induction of apoptosis and research of angiogenesis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 13114-29-9 |
| Pricing | Inquire |
| Cas | 13114-29-9 |
| Molecular Weight | 218.22 |
| Molecular Formula | C8H19O5Na |
| Canonical SMILES | C1CC2C(C(C1O2)C(=O)[O-])C(=O)[O-].[Na+].[Na+] |