2'-Deoxy-6-thioguanosine-5'-monophosphate
2'-Deoxy-6-thioguanosine-5'-monophosphate is an innovative pharmaceutical entity, exquisitely designed for unveiling remarkable antiviral potency, assiduously directing its action towards impeding the pernicious propagation of RNA viruses. Deploying its inhibitory prowess upon viral enzyme activity, it efficaciously curtails the abhorrent virus's proclivity to proliferate, ensuing in a substantial amelioration of both the intensity and duration of the affliction.
| Supplier | BOC Sciences |
|---|---|
| Product # | 15303-00-1 |
| Pricing | Inquire |
| Cas | 15303-00-1 |
| Molecular Weight | 363.29 |
| Molecular Formula | C10H14N5O6PS |
| Canonical SMILES | C1C(C(OC1N2C=NC3=C2NC(=NC3=S)N)COP(=O)(O)O)O |