5-N-Acetyl-9-O-acetyl neuraminic acid
5-N-Acetyl-9-O-acetyl neuraminic acid, an indispensable compound widely utilized in the biomedical sector, presents promising therapeutic prospects for tackling neurological disorders as well as viral infections. Its distinctive chemical characteristics position it as a pivotal ingredient in the creation of groundbreaking pharmaceuticals aiming to effectively combat diverse ailments such as influenza and specific forms of malignancies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 55717-54-9 |
| Pricing | Inquire |
| Cas | 55717-54-9 |
| Molecular Weight | 351.31 |
| Molecular Formula | C13H21NO10 |
| Canonical SMILES | CC(=O)NC1C(CC(OC1C(C(COC(=O)C)O)O)(C(=O)O)O)O |