5-Benzylaminocarbony-2'-O-methyluridine
5-Benzylaminocarbony-2'-O-methyluridine is a remarkable biomedical compound, exerting its efficacious antiviral effects through the remarkable mechanism of nucleoside analog action. By seamlessly incorporating itself into the intricate viral DNA or RNA, it adeptly hampers the pernicious flourish of viral replication.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1648558-95-5 |
| Pricing | Inquire |
| Cas | 1648558-95-5 |
| Molecular Weight | 391.38 |
| Molecular Formula | C18H21N3O7 |
| Canonical SMILES | COC1C(C(OC1N2C=C(C(=O)NC2=O)C(=O)NCC3=CC=CC=C3)CO)O |