S-Methylisothiourea hemisulfate salt
(S)-Methylisothiourea sulfate is a more potent than NMMA as an inhibitor of inducible nitric oxide synthetase (iNOS). The Ki values are 120, 200, and 160 nM using purified human iNOS, eNOS, and nNOS, respectively.
| Supplier | BOC Sciences |
|---|---|
| Product # | 867-44-7 |
| Pricing | Inquire |
| Cas | 867-44-7 |
| Molecular Weight | 139.19 |
| Molecular Formula | C4H14N4O4S3 |
| Canonical SMILES | CSC(=N)N.CSC(=N)N.OS(=O)(=O)O |