3'-Deoxy-3'-fluoro-2'-C-methylguanosine
3'-Deoxy-3'-fluoro-2'-C-methylguanosine, a remarkable compound renowned for its antiviral properties, finds extensive applications in the biomedicine industry. This mighty warrior exhibits profound efficacy in combating viral infections emanating from notorious culprits like hepatitis C and dengue fever. By skillfully impeding viral RNA synthesis, it orchestrates a magnificent symphony that curtails viral replication and effectively curbs the relentless progression of these debilitating ailments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1434144-21-4 |
| Pricing | Inquire |
| Cas | 1434144-21-4 |
| Molecular Weight | 299.26 |
| Molecular Formula | C11H14FN5O4 |
| Canonical SMILES | CC1(C(C(OC1N2C=NC3=C2N=C(NC3=O)N)CO)F)O |