1,4-b-D-Xylobiitol
1,4-b-D-Xylobiitol is a composite of multiple hydroxyl groups, employed as a benchmark substance for precise analytics. Its utilization predominantly dwells in studies probing pathologies where metabolic perturbations prevail, specifically those tethered to disorders of xylose metabolism.
| Supplier | BOC Sciences |
|---|---|
| Product # | 20237-70-1 |
| Pricing | Inquire |
| Cas | 20237-70-1 |
| Molecular Weight | 284.26 |
| Molecular Formula | C10H20O9 |
| Canonical SMILES | C1C(C(C(C(O1)OC(CO)C(C(CO)O)O)O)O)O |