Ochratoxin C
A minor component of the ochratoxin complex produced by Aspergillus orchraceus and penicillium sp. It is a mycotoxin associated with food spoilage. It is the ethyl ester of ochratoxin A and represents a different hazard to the acidic major components ochratoxins A and B.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-04439 |
| Pricing | Inquire |
| Cas | 4865-85-4 |
| Molecular Weight | 431.87 |
| Molecular Formula | C22H22ClNO6 |
| Canonical SMILES | CCOC(=O)C(CC1=CC=CC=C1)NC(=O)C2=CC(=C3CC(OC(=O)C3=C2O)C)Cl |