Tienilic Acid
Tienilic acid is a heterocyclic derivative of phenoxyacetic acid that acts as a suicide substrate at the cytochrome P450 enzymes involved in drug metabolism. It is a good mechanism based inhibitor of CYP2C9, and is commonly used as diuretic, uricosuric, antihypertensive.
| Supplier | BOC Sciences |
|---|---|
| Product # | 40180-04-9 |
| Pricing | Inquire |
| Cas | 40180-04-9 |
| Molecular Weight | 331.17 |
| Molecular Formula | C13H8Cl2O4S |
| Canonical SMILES | C1=CSC(=C1)C(=O)C2=C(C(=C(C=C2)OCC(=O)O)Cl)Cl |