Methyl 6-Amino-3,5-dibromopicolinate
Methyl 6-Amino-3,5-dibromopicolinate (CAS# 443956-21-6) is used as a reagent in the synthesis of imidazopyridines as Syk inhibitors. Also used as a reagent in the synthesis of quinoline, quinoxaline and naphthyridine derivatives as antibacterial agents.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB025594 |
| Pricing | Inquire |
| Cas | 443956-21-6 |
| Molecular Weight | 309.94 |
| Molecular Formula | C7H6Br2N2O2 |
| Canonical SMILES | COC(=O)C1=NC(=C(C=C1Br)Br)N |