Progesterone EP Impurity M
A derivative of Progesterone.Progesterone is an endogenous steroid and progestogen sex hormone involved in the menstrual cycle, pregnancy, and embryogenesis of humans and other species. Progesterone is also a crucial metabolic intermediate in the production of other endogenous steroids, including the sex hormones and the corticosteroids, and plays an important role in brain function as a neurosteroid.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2000-66-0 |
| Pricing | Inquire |
| Cas | 2000-66-0 |
| Molecular Weight | 314.47 |
| Molecular Formula | C21H30O2 |
| Canonical SMILES | CC(=O)C1CCC2C1(CCC3C2CCC4=CC(=O)CCC34C)C |