N-Boc-Lys-OtBu Hydrochloride
N-Boc-Lys(Z)-OtBu Hydrochloride is an intermediate used in the synthesis of Isodesmosine Chloride Hydrate (Synthetic) (I815051), which is a component of elastin and also it is extremely hygroscopic and must be stored over a desiccant such as silica gel.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB072434 |
| Pricing | Inquire |
| Cas | 7750-45-0 |
| Molecular Weight | 302.41 +(36.46) |
| Molecular Formula | C15H30N2O4·HCl |
| Canonical SMILES | CC(C)(C)OC(=O)C(CCCCN)NC(=O)OC(C)(C)C.Cl |