Mastoparan B
Mastoparan B (MPB) is a venom peptide isolated from Vespa basalis (black-bellied hornet), one of the dangerous vespine wasps found in Taiwan. Mastopran-B is the major active component of the venom of the hornet Vespa basalis and causes degranulation of mast cells as well as hemolysis on chicken, human and sheep erythrocytes. It also exhibits antimicrobial activity against both Gram-positive and -negative bacteria.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-011989 |
| Pricing | Inquire |
| Cas | 137354-65-5 |
| Molecular Weight | 1612.05 |
| Molecular Formula | C78H138N20O16 |
| Canonical SMILES | CCC(C)C(C(=O)NC(C(C)C)C(=O)NC(CO)C(=O)NC(CC1=CNC2=CC=CC=C21)C(=O)NC(C)C(=O)NC(CCCCN)C(=O)NC(CCCCN)C(=O)NC(C(C)C)C(=O)NC(CC(C)C)C(=O)N)NC(=O)C(CO)NC(=O)C(CCCCN)NC(=O)C(CC(C)C)NC(=O)C(CCCCN)NC(=O)C(CC(C)C)N |