N4-acetyl-O5'-trityl-2'deoxy-cytidine
N4-acetyl-O5'-trityl-2'deoxy-cytidine is a nucleoside analogue that has gained immense relevance in antiviral therapy for its potent efficacy in treating pathogenic viral infections. By inhibiting viral replication, this drug interferes with the growth of hepatitis C viruses and herpes, two highly infectious viruses. However, its effectiveness is further heightened when used with other antiviral drugs, creating a formidable arsenal against these intracellular parasites.
| Supplier | BOC Sciences |
|---|---|
| Product # | 40094-20-0 |
| Pricing | Inquire |
| Cas | 40094-20-0 |
| Molecular Weight | 511.57 |
| Molecular Formula | C30H29N3O5 |
| Canonical SMILES | CC(=O)NC1=NC(=O)N(C=C1)C2CC(C(O2)COC(C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5)O |