5-Thiazolylmethyl N-[(1R,4R)-4-Amino-5-phenyl-1-(phenylmethyl)pentyl]carbamate
5-Thiazolylmethyl N-[(1R,4R)-4-Amino-5-phenyl-1-(phenylmethyl)pentyl]carbamate is an intermediate in the synthesis of 9-(Desmorpholinylethyl) 7,9-(1-Hydroxyethylene) Cobicistat (D296915), an impurity of Cobicistat (O849600), an HIV protease inhibitor and has been coadministered with low-dose ritonavir (R535000) as a pharmacoenhancer, significantly increasing their plasma concentrations.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB056845 |
| Pricing | Inquire |
| Cas | 1004316-18-0 |
| Molecular Weight | 409.55 |
| Molecular Formula | C23H27N3O2S |
| Canonical SMILES | C1=CC=C(C=C1)CC(CCC(CC2=CC=CC=C2)NC(=O)OCC3=CN=CS3)N |