3-Bodipy-propanoic acid
BODIPY dyes are used to generate fluorescent conjugates of proteins, nucleotides, oligonucleotides and dextrans, as well as to prepare fluorescent enzyme substrates, fatty acids, phospholipids, lipopolysaccharides, receptor ligands and polystyrene microspheres.
Supplier | BOC Sciences |
---|---|
Product # | B0245-285195 |
Pricing | Inquire |
Cas | 165599-63-3 |
Molecular Weight | 292.093 |
Molecular Formula | C14H15BF2N2O2 |
Canonical SMILES | [B-]1(N2C(=CC(=C2C=C3[N+]1=C(C=C3)CCC(=O)O)C)C)(F)F |