7-CH-ADP / 5'-TuDP
7-CH-ADP is a cutting-edge biomedicine, acting as a proficient antagonist of adenosine diphosphate receptors in research of neurological disorders. While 5'-TuDP is an indispensable enzymatic substrate prominently employed in the field of biomedicine, orchestrating a pivotal role in facilitating the research and development of nucleotides, thereby bolstering the essential processes of DNA replication and repair.
| Supplier | BOC Sciences |
|---|---|
| Product # | 21080-53-5 |
| Pricing | Inquire |
| Cas | 21080-53-5 |
| Molecular Weight | 426.2 (free acid) |
| Molecular Formula | C11H16N4O10P2 (free acid) |
| Canonical SMILES | C1=CN(C2=NC=NC(=C21)N)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O |