Antibiotic A-130B
It is a polyether antibiotic produced by the strain of Streptomyces hygroscopicus A-130. It has the effect of anti-gram-positive bacteria, mycobacterium and protozoa, and can be used as a feed additive to control Eimeriatenella infection.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-03030 |
| Pricing | Inquire |
| Cas | 73492-07-6 |
| Molecular Weight | 995.28 |
| Molecular Formula | C54H90O16 |
| Canonical SMILES | CC1CCC(OC12C(CC(O2)C3C(C(C(C(O3)(CO)O)C)OC4CCC(C(O4)C)OC)C)C)C5(CCC6(O5)C(C(CC(O6)C(C)C=C(C)C(=O)C(C)CC(C)C(=O)O)OC7CCC(C(O7)C)OC)C)C |