3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine
3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine is a biomedical compound used in the development of drugs for the treatment of various diseases. Extensive research has shown its potential in targeting specific enzymes or receptors involved in the progression of cancer, inflammation, and neurological disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1198094-97-1 |
| Pricing | Inquire |
| Cas | 1198094-97-1 |
| Molecular Weight | 312.1 |
| Molecular Formula | C14H16BF3N2O2 |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CNC3=NC=C(C=C23)C(F)(F)F |