06:0 PA (sodium salt)
06:0 PA (sodium salt), a crucial biochemical compound, plays a pivotal role in the exploration of cellular metabolism and lipid signaling mechanisms within the realm of scientific research. Its potential therapeutic efficacy in targeting metabolic disorders and inflammatory diseases is currently under intensive investigation by scholarly experts in the field.
| Supplier | BOC Sciences |
|---|---|
| Product # | 321883-53-8 |
| Pricing | Inquire |
| Cas | 321883-53-8 |
| Molecular Weight | 390.34 |
| Molecular Formula | C15H28NaO8P |
| Canonical SMILES | CCCCCC(=O)OCC(COP(=O)(O)[O-])OC(=O)CCCCC.[Na+] |