2'-O-(2-Methoxyethyl)-2-aminoadenosine
2'-O-(2-Methoxyethyl)-2-aminoadenosine is a vital compound widely used in the biomedical industry. It exhibits potent antiviral properties, making it a valuable tool in the treatment and research of viral infections such as HIV.
Supplier | BOC Sciences |
---|---|
Product # | 256224-13-2 |
Pricing | Inquire |
Cas | 256224-13-2 |
Molecular Weight | 340.34 |
Molecular Formula | C13H20N6O5 |
Canonical SMILES | COCCOC1C(C(OC1N2C=NC3=C(N=C(N=C32)N)N)CO)O |