Erlotinib-[13C6]
Erlotinib-[13C6] is the labelled analogue of Erlotinib. Erlotinib is a tyrosine kinase inhibitor which acts on the epidermal growth factor receptor (EGFR), inhibiting EGFR-associated kinase activity. Erlotinib is a medication used to treat non-small cell lung cancer and pancreatic cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-013654 |
| Pricing | Inquire |
| Cas | 1211107-68-4 |
| Molecular Weight | 399.39 |
| Molecular Formula | C16[13C]6H23N3O4 |
| Canonical SMILES | COCCOC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC=CC(=C3)C#C)OCCOC |