5-Difluoromethyluridine
5-Difluoromethyluridine, a remarkable biomedicine renowned for its effectiveness in combating both viral infections and cancer, has emerged as a formidable force in the realm of therapeutic interventions. Through its adept inhibition of viral nucleic acid synthesis, it boldly assumes the role of an efficacious antiviral agent. Simultaneously, its profound interference with the growth and division of cancer cells unveils its tremendous potential as an indispensable anticancer ally.
| Supplier | BOC Sciences |
|---|---|
| Product # | 110483-84-6 |
| Pricing | Inquire |
| Cas | 110483-84-6 |
| Molecular Weight | 294.21 |
| Molecular Formula | C10H12F2N2O6 |
| Canonical SMILES | C1=C(C(=O)NC(=O)N1C2C(C(C(O2)CO)O)O)C(F)F |