7-Oxo-7,8-dihydro-6H-pyrimido[5,4-b][1,4]oxazine-2-carboxaldehyde
7-Oxo-7,8-dihydro-6H-pyrimido[5,4-b][1,4]oxazine-2-carboxaldehyde was used as a reagent in the development and optimization of novel bacterial topoisomerase type II inhibitors which show potential for use in development of antimicrobial agents against drug resistant pseudomonas aeruginosa.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB056707 |
| Pricing | Inquire |
| Cas | 1003946-48-2 |
| Molecular Weight | 179.13 |
| Molecular Formula | C7H5N3O3 |
| Canonical SMILES | C1C(=O)NC2=NC(=NC=C2O1)C=O |