Fmoc-Phe(CF2PO3)-OH
Fmoc-Phe(CF2PO3)-OH, a reagent employed in peptide synthesis, facilitates the adjustment or labeling of amino acids. Widely applied in pharmaceutical drug synthesis, specifically targeting a range of ailments such as cancer and autoimmune disorders, this compound plays a pivotal role in the advancement of medical science.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-008971 |
| Pricing | Inquire |
| Cas | 160751-44-0 |
| Molecular Weight | 517.42 |
| Molecular Formula | C25H22F2NO7P |
| Canonical SMILES | CCOP(=O)(C(C1=CC=C(C=C1)CC(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)(F)F)OCC |