1,2:3,4:5,6-Tri-O-isopropylidene-D-gluconate
1,2:3,4:5,6-Tri-O-isopropylidene-D-gluconate, a crucial synthetic intermediate for various drugs including dapagliflozin, empagliflozin, and canagliflozin, among others, has gained significant spotlight in the pharmaceutical industry for its role in treating type 2 diabetes. Its usage as an intermediary has created a promising avenue for medical synthesis and research, thereby augmenting the application of this compound in diverse fields.
| Supplier | BOC Sciences |
|---|---|
| Product # | 52492-60-1 |
| Pricing | Inquire |
| Cas | 52492-60-1 |
| Molecular Weight | 316.35 |
| Molecular Formula | C15H24O7 |
| Canonical SMILES | CC1(OCC(O1)C2C(OC(O2)(C)C)C3C(=O)OC(O3)(C)C)C |