3-Sulfopropyl acrylate potassium salt
3-Sulfopropyl acrylate, potassium salt (SPAK) is a functional acrylic acid monomer useful in the synthesis of new generation of super water absorbent, superporous, polymer hydrogels. SPAK mainly used to improve hydrogel properties; e.g., stabilize waterborne acrylic dispersion, adhesion, ion exchange resin and poly-electrolytes. SPAK also helps improve antistatic properties of polymers.
| Supplier | BOC Sciences |
|---|---|
| Product # | 31098-20-1 |
| Pricing | Inquire |
| Cas | 31098-20-1 |
| Molecular Weight | 232.30 |
| Molecular Formula | C6H9KO5S |
| Canonical SMILES | C=CC(=O)OCCCS(=O)(=O)[O-].[K+] |