Kasugamycin hydrochloride hydrate
Kasugamycin, an aminoglycosidic antibiotic, inhibits protein synthesis by interacting with the 30S ribosomal subunit. The mechanism of inhibition of protein synthesis seems to be different from that of other aminoglycosides such as streptomycin, kanamycin
| Supplier | BOC Sciences |
|---|---|
| Product # | 200132-83-8 |
| Pricing | Inquire |
| Cas | 200132-83-8 |
| Molecular Weight | 433.84 |
| Molecular Formula | C14H28ClN3O10 |
| Canonical SMILES | CC1C(CC(C(O1)OC2C(C(C(C(C2O)O)O)O)O)N)N=C(C(=O)O)N.O.Cl |