Deferiprone 3-O-b-D-glucuronide
Deferiprone 3-O-b-D-glucuronide is a biomedicine used in the treatment of iron overload disorders, such as thalassemia and sickle cell anemia. It acts as an iron chelator helping to remove excess iron from the body. Its effectiveness in reducing iron levels has been studied extensively and it holds promise in improving overall patient health.
| Supplier | BOC Sciences |
|---|---|
| Product # | 141675-48-1 |
| Pricing | Inquire |
| Cas | 141675-48-1 |
| Molecular Weight | 315.28 |
| Molecular Formula | C13H17NO8 |
| Canonical SMILES | CC1=C(C(=O)C=CN1C)OC2C(C(C(C(O2)C(=O)O)O)O)O |