4-Chlorobenzylzinc chloride solution
4-Chlorobenzylzinc chloride solution is a vital component in the biomedical industry, used for the development of drugs aiming to treat various diseases. With its unique properties, this solution plays a crucial role in the synthesis of pharmaceutical compounds for conditions such as cancer, inflammation, and microbial infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 149923-10-4 |
| Pricing | Inquire |
| Cas | 149923-10-4 |
| Molecular Weight | 226.42 |
| Molecular Formula | ClC6H4CH2ZnCl |
| Canonical SMILES | [CH2-]C1=CC=C(C=C1)Cl.Cl[Zn+] |