2,3-Dihydro-1-hydroxy-1H-indene-1-carboxylic Acid Methyl Ester
2,3-Dihydro-1-hydroxy-1H-indene-1-carboxylic acid methyl ester is used as a reagent to synthesize 1-fluoroindan-1-carboxylic Acid (FICA), a compound that is used as a derivatizing agent to determine the absolute configuration of chiral secondary alcohols.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB067654 |
| Pricing | Inquire |
| Cas | 901773-92-0 |
| Molecular Weight | 192.21 |
| Molecular Formula | C11H12O3 |
| Canonical SMILES | COC(=O)C1(CCC2=CC=CC=C21)O |