(2E)-4-[2-Nitro-3-[(2,3,4,6-tetra-O-acetyl-b-D-glucopyranosyl)oxy]phenyl]-4-oxo-2-butenoic acid methyl ester
(2E)-4-[2-Nitro-3-[(2,3,4,6-tetra-O-acetyl-b-D-glucopyranosyl)oxy]phenyl]-4-oxo-2-butenoic acid methyl ester, known scientifically as a Biomedical Therapeutic Compound, provides potent solutions for various medical conditions such as cancer and inflammatory disorders. This extraordinary compound has demonstrated remarkable anti-inflammatory and anti-proliferative effects, rendering it indispensable for targeted therapies.
Supplier | BOC Sciences |
---|---|
Product # | 224044-68-2 |
Pricing | Inquire |
Cas | 224044-68-2 |
Molecular Weight | 581.48 |
Molecular Formula | C25H27NO15 |
Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)OC2=CC=CC(=C2[N+](=O)[O-])C(=O)C=CC(=O)OC)OC(=O)C)OC(=O)C)OC(=O)C |