4,4'-Stilbenedicarboxylic acid
4,4'-Stilbenedicarboxylic acid (SDA) is a luminescent ligand that is useful as an organic linker due to the presence of two carboxylic groups, which form bridges between metallic centers. It has conjugated aromatic rings that facilitate the formation of a rigid linker. SDA can be used in the hydrothermal synthesis of three-dimensional (3D) metal-organic frameworks, which have potential usage in sensing, drug delivery, luminescence, and gas adsorption. It may also be used in energy storage applications such as supercapacitors and batteries.
| Supplier | BOC Sciences |
|---|---|
| Product # | 100-31-2 |
| Pricing | Inquire |
| Cas | 100-31-2 |
| Molecular Weight | 268.27 |
| Molecular Formula | C16H12O4 |
| Canonical SMILES | C1=CC(=CC=C1C=CC2=CC=C(C=C2)C(=O)O)C(=O)O |