Tylosin A
A highly purified form of tylosin A. It is a macrolide antibiotic, which is considered to be the major component of tylosin (comprises approximately 90% of tylosin). However, tylosins B, C and D contribute to the overall potency of tylosin.
| Supplier | BOC Sciences |
|---|---|
| Product # | 8026-48-0 |
| Pricing | Inquire |
| Cas | 8026-48-0 |
| Molecular Weight | 916.10 |
| Molecular Formula | C46H77NO17 |
| Canonical SMILES | CCC1C(C=C(C=CC(=O)C(CC(C(C(C(CC(=O)O1)O)C)OC2C(C(C(C(O2)C)OC3CC(C(C(O3)C)O)(C)O)N(C)C)O)CC=O)C)C)COC4C(C(C(C(O4)C)O)OC)OC |