Endomorphin 1
Endomorphin 1 is a high affinity (Ki = 360 pM) and highly selective agonist of theμ-opioid receptor with 4000- and 15000-fold preference over δ and κ respectively and displays reasonable affinities for kappa3 binding sites, with Ki value between 20 and 30 nM.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-015992 |
| Pricing | Inquire |
| Cas | 189388-22-5 |
| Molecular Weight | 610.7 |
| Molecular Formula | C34H38N6O5 |
| Canonical SMILES | C1CC(N(C1)C(=O)C(CC2=CC=C(C=C2)O)N)C(=O)NC(CC3=CNC4=CC=CC=C43)C(=O)NC(CC5=CC=CC=C5)C(=O)N |