2-Amino-3-bromo-5-(trifluoromethyl)pyridine
2-Amino-3-bromo-5-(trifluoromethyl)pyridine (CAS# 79456-30-7) is a useful research chemical. It acts as a reagent used in the preparation of fluazaindolizine, a new highly effective and selective product for the control of plant parasitic nematodes.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB036353 |
| Pricing | Inquire |
| Cas | 79456-30-7 |
| Molecular Weight | 241.01 |
| Molecular Formula | C6H4BrF3N2 |
| Canonical SMILES | C1=C(C=NC(=C1Br)N)C(F)(F)F |