Marinopyrrole A
Marinopyrrole A, a new Mcl-1 inhibitor, could influence Mcl-1-Bim interaction and induce the degradation of Mcl-1 proteasomal and also lead to the apoptosis of Mcl-1-dependent cancer cells. IC50: 10.1 uM.
Supplier | BOC Sciences |
---|---|
Product # | 1227962-62-0 |
Pricing | Inquire |
Cas | 1227962-62-0 |
Molecular Weight | 510.15 |
Molecular Formula | C22H12Cl4N2O4 |
Canonical SMILES | OC1=CC=CC=C1C(C2=C(N3C(C(C4=CC=CC=C4O)=O)=CC(Cl)=C3Cl)C(Cl)=C(Cl)N2)=O |